C24H20N2O4 — CID 95564600
(Z)-3-(2-aminophenyl)-2-[3-[(Z)-2-(2-aminophenyl)-1-carboxyethenyl]phenyl]prop-2-enoic acid (PubChem CID 95564600) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (Z)-3-(2-aminophenyl)-2-[3-[(Z)-2-(2-aminophenyl)-1-carboxyethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(2-aminophenyl)-2-[3-[(Z)-2-(2-aminophenyl)-1-carboxyethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 95564600 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (Z)-3-(2-aminophenyl)-2-[3-[(Z)-2-(2-aminophenyl)-1-carboxyethenyl]phenyl]prop-2-enoic acid |
| SMILES | Nc1ccccc1/C=C(\C(=O)O)c1cccc(/C(=C/c2ccccc2N)C(=O)O)c1 |
| InChI | InChI=1S/C24H20N2O4/c25-21-10-3-1-6-17(21)13-19(23(27)28)15-8-5-9-16(12-15)20(24(29)30)14-18-7-2-4-11-22(18)26/h1-14H,25-26H2,(H,27,28)(H,29,30)/b19-13-,20-14- |
| InChIKey | XCEOTJVUVCCYHV-AXPXABNXSA-N |
| XLogP | 4.10 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|