C17H13FO4 — CID 83951037
(Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-fluorophenyl)prop-2-enoic acid (PubChem CID 83951037) has the molecular formula C17H13FO4 and a molecular weight of 300.28 g/mol. Its IUPAC name is (Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-fluorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-fluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83951037 |
| Molecular Formula | C17H13FO4 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-fluorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1F)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H13FO4/c18-14-4-2-1-3-12(14)9-13(17(19)20)11-5-6-15-16(10-11)22-8-7-21-15/h1-6,9-10H,7-8H2,(H,19,20)/b13-9- |
| InChIKey | XNVVXTGDJOTJQM-LCYFTJDESA-N |
| XLogP | 3.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|