C16H11ClO4 — CID 83955984
(Z)-2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)prop-2-enoic acid (PubChem CID 83955984) has the molecular formula C16H11ClO4 and a molecular weight of 302.71 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83955984 |
| Molecular Formula | C16H11ClO4 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cccc(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11ClO4/c17-12-3-1-2-10(6-12)7-13(16(18)19)11-4-5-14-15(8-11)21-9-20-14/h1-8H,9H2,(H,18,19)/b13-7- |
| InChIKey | AAAPAGPQOZYGGM-QPEQYQDCSA-N |
| XLogP | 3.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|