C29H19ClN2O4 — CID 10255211
(Z)-3-[5-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylpyrazol-3-yl]-2-(3-chlorophenyl)prop-2-enoic acid (PubChem CID 10255211) has the molecular formula C29H19ClN2O4 and a molecular weight of 494.93 g/mol. Its IUPAC name is (Z)-3-[5-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylpyrazol-3-yl]-2-(3-chlorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-[5-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylpyrazol-3-yl]-2-(3-chlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 10255211 |
| Molecular Formula | C29H19ClN2O4 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (Z)-3-[5-(1,3-benzodioxol-5-yl)-1-naphthalen-2-ylpyrazol-3-yl]-2-(3-chlorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cc(-c2ccc3c(c2)OCO3)n(-c2ccc3ccccc3c2)n1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H19ClN2O4/c30-22-7-3-6-20(12-22)25(29(33)34)15-23-16-26(21-9-11-27-28(14-21)36-17-35-27)32(31-23)24-10-8-18-4-1-2-5-19(18)13-24/h1-16H,17H2,(H,33,34)/b25-15- |
| InChIKey | ICEFHMSVJLAMHD-MYYYXRDXSA-N |
| XLogP | 6.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|