C25H17Cl3N2O3 — CID 22171108
(E)-2-(3-chlorophenyl)-3-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]prop-2-enoic acid (PubChem CID 22171108) has the molecular formula C25H17Cl3N2O3 and a molecular weight of 499.78 g/mol. Its IUPAC name is (E)-2-(3-chlorophenyl)-3-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-(3-chlorophenyl)-3-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22171108 |
| Molecular Formula | C25H17Cl3N2O3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | (E)-2-(3-chlorophenyl)-3-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]prop-2-enoic acid |
| SMILES | COc1ccc(-n2nc(/C=C(/C(=O)O)c3cccc(Cl)c3)cc2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H17Cl3N2O3/c1-33-20-8-6-19(7-9-20)30-24(16-5-10-22(27)23(28)12-16)14-18(29-30)13-21(25(31)32)15-3-2-4-17(26)11-15/h2-14H,1H3,(H,31,32)/b21-13+ |
| InChIKey | YQCBMSKNPIORAW-FYJGNVAPSA-N |
| XLogP | 7.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|