C28H24Cl2N2O3 — CID 22171026
(E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoic acid (PubChem CID 22171026) has the molecular formula C28H24Cl2N2O3 and a molecular weight of 507.42 g/mol. Its IUPAC name is (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoic acid.
| Compound Name | (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 22171026 |
| Molecular Formula | C28H24Cl2N2O3 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoic acid |
| SMILES | COc1ccc(-n2nc(CC(/C=C/C(=O)O)c3cccc(C)c3)cc2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H24Cl2N2O3/c1-18-4-3-5-19(14-18)20(7-13-28(33)34)15-22-17-27(21-6-12-25(29)26(30)16-21)32(31-22)23-8-10-24(35-2)11-9-23/h3-14,16-17,20H,15H2,1-2H3,(H,33,34)/b13-7+ |
| InChIKey | SUUQQYLIEFUZQB-NTUHNPAUSA-N |
| XLogP | 7.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|