C29H26Cl2N2O3 — CID 68876040
methyl (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoate (PubChem CID 68876040) has the molecular formula C29H26Cl2N2O3 and a molecular weight of 521.44 g/mol. Its IUPAC name is methyl (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoate.
| Compound Name | methyl (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 68876040 |
| Molecular Formula | C29H26Cl2N2O3 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | methyl (E)-5-[5-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]-4-(3-methylphenyl)pent-2-enoate |
| SMILES | COC(=O)/C=C/C(Cc1cc(-c2ccc(Cl)c(Cl)c2)n(-c2ccc(OC)cc2)n1)c1cccc(C)c1 |
| InChI | InChI=1S/C29H26Cl2N2O3/c1-19-5-4-6-20(15-19)21(8-14-29(34)36-3)16-23-18-28(22-7-13-26(30)27(31)17-22)33(32-23)24-9-11-25(35-2)12-10-24/h4-15,17-18,21H,16H2,1-3H3/b14-8+ |
| InChIKey | OJMUJWPBQJLQJU-RIYZIHGNSA-N |
| XLogP | 7.22 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|