C18H11N3O5 — CID 169355913
5-(1,3-benzodioxol-5-yl)-1-(4-isocyanatophenyl)pyrazole-3-carboxylic acid (PubChem CID 169355913) has the molecular formula C18H11N3O5 and a molecular weight of 349.30 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1-(4-isocyanatophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1-(4-isocyanatophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 169355913 |
| Molecular Formula | C18H11N3O5 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1-(4-isocyanatophenyl)pyrazole-3-carboxylic acid |
| SMILES | O=C=Nc1ccc(-n2nc(C(=O)O)cc2-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H11N3O5/c22-9-19-12-2-4-13(5-3-12)21-15(8-14(20-21)18(23)24)11-1-6-16-17(7-11)26-10-25-16/h1-8H,10H2,(H,23,24) |
| InChIKey | SCNJQFBQPSVROG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|