C23H15N3O2 — CID 141141743
4-[5-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-3-yl]benzonitrile (PubChem CID 141141743) has the molecular formula C23H15N3O2 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[5-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-3-yl]benzonitrile.
| Compound Name | 4-[5-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 141141743 |
| Molecular Formula | C23H15N3O2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-[5-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc4c(c3)OCO4)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H15N3O2/c24-14-16-6-8-17(9-7-16)20-13-21(26(25-20)19-4-2-1-3-5-19)18-10-11-22-23(12-18)28-15-27-22/h1-13H,15H2 |
| InChIKey | VNKGESKZXBHIIH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |