C11H6N2O4 — CID 83918372
5-(1,3-benzodioxol-5-yl)-3-isocyanato-1,2-oxazole (PubChem CID 83918372) has the molecular formula C11H6N2O4 and a molecular weight of 230.18 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-isocyanato-1,2-oxazole.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-isocyanato-1,2-oxazole |
|---|---|
| PubChem CID | 83918372 |
| Molecular Formula | C11H6N2O4 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-isocyanato-1,2-oxazole |
| SMILES | O=C=Nc1cc(-c2ccc3c(c2)OCO3)on1 |
| InChI | InChI=1S/C11H6N2O4/c14-5-12-11-4-9(17-13-11)7-1-2-8-10(3-7)16-6-15-8/h1-4H,6H2 |
| InChIKey | RPUFSODUYOOMEA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|