C13H8N2O3 — CID 83919410
4-(1,3-benzodioxol-5-yl)-3-isocyanatopyridine (PubChem CID 83919410) has the molecular formula C13H8N2O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-isocyanatopyridine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-isocyanatopyridine |
|---|---|
| PubChem CID | 83919410 |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-isocyanatopyridine |
| SMILES | O=C=Nc1cnccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H8N2O3/c16-7-15-11-6-14-4-3-10(11)9-1-2-12-13(5-9)18-8-17-12/h1-6H,8H2 |
| InChIKey | QSIZABAZCGKUQV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|