C25H18N2O6 — CID 155202227
4,5-bis(1,3-benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide (PubChem CID 155202227) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is 4,5-bis(1,3-benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide.
| Compound Name | 4,5-bis(1,3-benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 155202227 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4,5-bis(1,3-benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cc(-c2ccc3c(c2)OCO3)c(-c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C25H18N2O6/c28-25(27-12-15-5-7-26-8-6-15)23-11-18(16-1-3-19-21(9-16)31-13-29-19)24(33-23)17-2-4-20-22(10-17)32-14-30-20/h1-11H,12-14H2,(H,27,28) |
| InChIKey | MNUWKDIZZYAFJL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |