C16H12N2O2 — CID 82582591
N-(1,3-benzodioxol-5-yl)isoquinolin-6-amine (PubChem CID 82582591) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)isoquinolin-6-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)isoquinolin-6-amine |
|---|---|
| PubChem CID | 82582591 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)isoquinolin-6-amine |
| SMILES | c1cc2cc(Nc3ccc4c(c3)OCO4)ccc2cn1 |
| InChI | InChI=1S/C16H12N2O2/c1-2-13(7-11-5-6-17-9-12(1)11)18-14-3-4-15-16(8-14)20-10-19-15/h1-9,18H,10H2 |
| InChIKey | VCTAGEALPPPTOZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |