C25H23N9O2 — CID 10152064
2-N-(1,3-benzodioxol-5-yl)-4-N,6-N-bis[(Z)-1-pyridin-4-ylethylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 10152064) has the molecular formula C25H23N9O2 and a molecular weight of 481.52 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-4-N,6-N-bis[(Z)-1-pyridin-4-ylethylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-4-N,6-N-bis[(Z)-1-pyridin-4-ylethylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 10152064 |
| Molecular Formula | C25H23N9O2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-4-N,6-N-bis[(Z)-1-pyridin-4-ylethylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | C/C(=N/Nc1cc(N/N=C(/C)c2ccncc2)nc(Nc2ccc3c(c2)OCO3)n1)c1ccncc1 |
| InChI | InChI=1S/C25H23N9O2/c1-16(18-5-9-26-10-6-18)31-33-23-14-24(34-32-17(2)19-7-11-27-12-8-19)30-25(29-23)28-20-3-4-21-22(13-20)36-15-35-21/h3-14H,15H2,1-2H3,(H3,28,29,30,33,34)/b31-16-,32-17- |
| InChIKey | ZDTNOPZXICRJNX-GMMGGFQHSA-N |
| XLogP | 4.41 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|