C17H12Cl2N4O2 — CID 112906443
2-N-(1,3-benzodioxol-5-yl)-4-N-(3,5-dichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 112906443) has the molecular formula C17H12Cl2N4O2 and a molecular weight of 375.22 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-4-N-(3,5-dichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-4-N-(3,5-dichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112906443 |
| Molecular Formula | C17H12Cl2N4O2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-4-N-(3,5-dichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | Clc1cc(Cl)cc(Nc2ccnc(Nc3ccc4c(c3)OCO4)n2)c1 |
| InChI | InChI=1S/C17H12Cl2N4O2/c18-10-5-11(19)7-13(6-10)21-16-3-4-20-17(23-16)22-12-1-2-14-15(8-12)25-9-24-14/h1-8H,9H2,(H2,20,21,22,23) |
| InChIKey | LXIQUDDNDMCDMS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |