C22H23N5O2 — CID 112906145
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112906145) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112906145 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | c1cc(Nc2ccc3c(c2)OCCO3)nc(Nc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C22H23N5O2/c1-2-12-27(11-1)18-6-3-16(4-7-18)25-22-23-10-9-21(26-22)24-17-5-8-19-20(15-17)29-14-13-28-19/h3-10,15H,1-2,11-14H2,(H2,23,24,25,26) |
| InChIKey | LGWAMYXCCCHQHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|