C18H13N5O2 — CID 112906449
2-[[2-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112906449) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112906449 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1ccnc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C18H13N5O2/c19-10-12-3-1-2-4-14(12)22-17-7-8-20-18(23-17)21-13-5-6-15-16(9-13)25-11-24-15/h1-9H,11H2,(H2,20,21,22,23) |
| InChIKey | JDDBWMPNHFMRLE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |