C18H15N5 — CID 112901878
2-[[2-(2-methylanilino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112901878) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[[2-(2-methylanilino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[2-(2-methylanilino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112901878 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[[2-(2-methylanilino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1ccccc1Nc1nccc(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C18H15N5/c1-13-6-2-4-8-15(13)22-18-20-11-10-17(23-18)21-16-9-5-3-7-14(16)12-19/h2-11H,1H3,(H2,20,21,22,23) |
| InChIKey | CNCANJLGRAZIIL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |