C13H11N3O2S — CID 55156079
4-(1,3-benzodioxol-5-ylamino)pyridine-2-carbothioamide (PubChem CID 55156079) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylamino)pyridine-2-carbothioamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylamino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 55156079 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylamino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(Nc2ccc3c(c2)OCO3)ccn1 |
| InChI | InChI=1S/C13H11N3O2S/c14-13(19)10-5-9(3-4-15-10)16-8-1-2-11-12(6-8)18-7-17-11/h1-6H,7H2,(H2,14,19)(H,15,16) |
| InChIKey | SWDKFMVSANLWHL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|