C14H10NO5- — CID 86699962
[4-(1,3-benzodioxol-5-yl)-3-methyl-2-pyridinyl] carbonate (PubChem CID 86699962) has the molecular formula C14H10NO5- and a molecular weight of 272.24 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)-3-methyl-2-pyridinyl] carbonate.
| Compound Name | [4-(1,3-benzodioxol-5-yl)-3-methyl-2-pyridinyl] carbonate |
|---|---|
| PubChem CID | 86699962 |
| Molecular Formula | C14H10NO5- |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)-3-methyl-2-pyridinyl] carbonate |
| SMILES | Cc1c(-c2ccc3c(c2)OCO3)ccnc1OC(=O)[O-] |
| InChI | InChI=1S/C14H11NO5/c1-8-10(4-5-15-13(8)20-14(16)17)9-2-3-11-12(6-9)19-7-18-11/h2-6H,7H2,1H3,(H,16,17)/p-1 |
| InChIKey | SQKFVTMRKVJTKD-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 80.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |