C16H10Cl2O4 — CID 83954049
2-[(Z)-2-carboxy-2-(3,4-dichlorophenyl)ethenyl]benzoic acid (PubChem CID 83954049) has the molecular formula C16H10Cl2O4 and a molecular weight of 337.16 g/mol. Its IUPAC name is 2-[(Z)-2-carboxy-2-(3,4-dichlorophenyl)ethenyl]benzoic acid.
| Compound Name | 2-[(Z)-2-carboxy-2-(3,4-dichlorophenyl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 83954049 |
| Molecular Formula | C16H10Cl2O4 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 2-[(Z)-2-carboxy-2-(3,4-dichlorophenyl)ethenyl]benzoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2O4/c17-13-6-5-10(8-14(13)18)12(16(21)22)7-9-3-1-2-4-11(9)15(19)20/h1-8H,(H,19,20)(H,21,22)/b12-7- |
| InChIKey | IPEZOORYBOHZMF-GHXNOFRVSA-N |
| XLogP | 4.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|