C19H18O5 — CID 83954063
2-[(Z)-2-carboxy-2-(4-ethoxy-2-methylphenyl)ethenyl]benzoic acid (PubChem CID 83954063) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[(Z)-2-carboxy-2-(4-ethoxy-2-methylphenyl)ethenyl]benzoic acid.
| Compound Name | 2-[(Z)-2-carboxy-2-(4-ethoxy-2-methylphenyl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 83954063 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(Z)-2-carboxy-2-(4-ethoxy-2-methylphenyl)ethenyl]benzoic acid |
| SMILES | CCOc1ccc(/C(=C/c2ccccc2C(=O)O)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C19H18O5/c1-3-24-14-8-9-15(12(2)10-14)17(19(22)23)11-13-6-4-5-7-16(13)18(20)21/h4-11H,3H2,1-2H3,(H,20,21)(H,22,23)/b17-11- |
| InChIKey | ZLQCIODAOUKNEC-BOPFTXTBSA-N |
| XLogP | 3.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|