C16H10BrNO6 — CID 6508920
(Z)-2-(6-bromo-1,3-benzodioxol-5-yl)-3-(2-nitrophenyl)prop-2-enoic acid (PubChem CID 6508920) has the molecular formula C16H10BrNO6 and a molecular weight of 392.16 g/mol. Its IUPAC name is (Z)-2-(6-bromo-1,3-benzodioxol-5-yl)-3-(2-nitrophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(6-bromo-1,3-benzodioxol-5-yl)-3-(2-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6508920 |
| Molecular Formula | C16H10BrNO6 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | (Z)-2-(6-bromo-1,3-benzodioxol-5-yl)-3-(2-nitrophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1[N+](=O)[O-])c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C16H10BrNO6/c17-12-7-15-14(23-8-24-15)6-10(12)11(16(19)20)5-9-3-1-2-4-13(9)18(21)22/h1-7H,8H2,(H,19,20)/b11-5- |
| InChIKey | CYBXTLNYKZUINH-WZUFQYTHSA-N |
| XLogP | 3.71 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|