C16H12BrNO7 — CID 7433944
(6-bromo-1,3-benzodioxol-5-yl)methyl 2-(2-nitrophenoxy)acetate (PubChem CID 7433944) has the molecular formula C16H12BrNO7 and a molecular weight of 410.18 g/mol. Its IUPAC name is (6-bromo-1,3-benzodioxol-5-yl)methyl 2-(2-nitrophenoxy)acetate.
| Compound Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7433944 |
| Molecular Formula | C16H12BrNO7 |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 2-(2-nitrophenoxy)acetate |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])OCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C16H12BrNO7/c17-11-6-15-14(24-9-25-15)5-10(11)7-23-16(19)8-22-13-4-2-1-3-12(13)18(20)21/h1-6H,7-9H2 |
| InChIKey | KOYYHHIJDZPCLE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|