C21H25NO5 — CID 7889853
(4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2-nitrophenoxy)acetate (PubChem CID 7889853) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2-nitrophenoxy)acetate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7889853 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2-nitrophenoxy)acetate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1COC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25NO5/c1-14-10-16(21(3,4)5)11-15(2)17(14)12-27-20(23)13-26-19-9-7-6-8-18(19)22(24)25/h6-11H,12-13H2,1-5H3 |
| InChIKey | MHHDHVPULAFJGX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|