C22H18Cl2N2O4-2 — CID 163164105
4-[(1S,2S)-1,2-dichloro-2-phenylethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxido-6-(2-phenylethenyl)benzene-1,3-diamine (PubChem CID 163164105) has the molecular formula C22H18Cl2N2O4-2 and a molecular weight of 445.30 g/mol. Its IUPAC name is 4-[(1S,2S)-1,2-dichloro-2-phenylethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxido-6-(2-phenylethenyl)benzene-1,3-diamine.
| Compound Name | 4-[(1S,2S)-1,2-dichloro-2-phenylethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxido-6-(2-phenylethenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 163164105 |
| Molecular Formula | C22H18Cl2N2O4-2 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 4-[(1S,2S)-1,2-dichloro-2-phenylethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxido-6-(2-phenylethenyl)benzene-1,3-diamine |
| SMILES | [O-]N([O-])c1cc(N(O)O)c([C@H](Cl)[C@@H](Cl)c2ccccc2)cc1C=Cc1ccccc1 |
| InChI | InChI=1S/C22H18Cl2N2O4/c23-21(16-9-5-2-6-10-16)22(24)18-13-17(12-11-15-7-3-1-4-8-15)19(25(27)28)14-20(18)26(29)30/h1-14,21-22,29-30H/q-2/t21-,22-/m0/s1 |
| InChIKey | FYNJGUULTKUUBC-VXKWHMMOSA-N |
| XLogP | 6.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|