C22H18N4O8-4 — CID 163177852
4-[2-[4-[2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethenyl]phenyl]ethenyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine (PubChem CID 163177852) has the molecular formula C22H18N4O8-4 and a molecular weight of 466.41 g/mol. Its IUPAC name is 4-[2-[4-[2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethenyl]phenyl]ethenyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine.
| Compound Name | 4-[2-[4-[2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethenyl]phenyl]ethenyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine |
|---|---|
| PubChem CID | 163177852 |
| Molecular Formula | C22H18N4O8-4 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4-[2-[4-[2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethenyl]phenyl]ethenyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine |
| SMILES | [O-]N([O-])c1ccc(C=Cc2ccc(C=Cc3ccc(N([O-])[O-])cc3N(O)O)cc2)c(N(O)O)c1 |
| InChI | InChI=1S/C22H18N4O8/c27-23(28)19-11-9-17(21(13-19)25(31)32)7-5-15-1-2-16(4-3-15)6-8-18-10-12-20(24(29)30)14-22(18)26(33)34/h1-14,31-34H/q-4 |
| InChIKey | DZMSRKKUYKIPDK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|