C15H12N3O4- — CID 21144817
3-N,3-N-dihydroxy-4-isoquinolin-2-ium-2-yl-1-N,1-N-dioxidobenzene-1,3-diamine (PubChem CID 21144817) has the molecular formula C15H12N3O4- and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-N,3-N-dihydroxy-4-isoquinolin-2-ium-2-yl-1-N,1-N-dioxidobenzene-1,3-diamine.
| Compound Name | 3-N,3-N-dihydroxy-4-isoquinolin-2-ium-2-yl-1-N,1-N-dioxidobenzene-1,3-diamine |
|---|---|
| PubChem CID | 21144817 |
| Molecular Formula | C15H12N3O4- |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-N,3-N-dihydroxy-4-isoquinolin-2-ium-2-yl-1-N,1-N-dioxidobenzene-1,3-diamine |
| SMILES | [O-]N([O-])c1ccc(-[n+]2ccc3ccccc3c2)c(N(O)O)c1 |
| InChI | InChI=1S/C15H12N3O4/c19-17(20)13-5-6-14(15(9-13)18(21)22)16-8-7-11-3-1-2-4-12(11)10-16/h1-10,21-22H/q-1 |
| InChIKey | XDKXVWHAEKXRAZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|