C16H16N4O4-2 — CID 163138273
2-N,2-N-dihydroxy-4-N,4-N-dioxido-1-N-[(2-prop-1-enylphenyl)methylideneamino]benzene-1,2,4-triamine (PubChem CID 163138273) has the molecular formula C16H16N4O4-2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-N,2-N-dihydroxy-4-N,4-N-dioxido-1-N-[(2-prop-1-enylphenyl)methylideneamino]benzene-1,2,4-triamine.
| Compound Name | 2-N,2-N-dihydroxy-4-N,4-N-dioxido-1-N-[(2-prop-1-enylphenyl)methylideneamino]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 163138273 |
| Molecular Formula | C16H16N4O4-2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-N,2-N-dihydroxy-4-N,4-N-dioxido-1-N-[(2-prop-1-enylphenyl)methylideneamino]benzene-1,2,4-triamine |
| SMILES | CC=Cc1ccccc1C=NNc1ccc(N([O-])[O-])cc1N(O)O |
| InChI | InChI=1S/C16H16N4O4/c1-2-5-12-6-3-4-7-13(12)11-17-18-15-9-8-14(19(21)22)10-16(15)20(23)24/h2-11,18,23-24H,1H3/q-2 |
| InChIKey | XGFHBZAPYCMKHJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|