C15H20N4O4-2 — CID 163163694
1-N-[(2-ethylcyclohexen-1-yl)methylideneamino]-2-N,2-N-dihydroxy-4-N,4-N-dioxidobenzene-1,2,4-triamine (PubChem CID 163163694) has the molecular formula C15H20N4O4-2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-N-[(2-ethylcyclohexen-1-yl)methylideneamino]-2-N,2-N-dihydroxy-4-N,4-N-dioxidobenzene-1,2,4-triamine.
| Compound Name | 1-N-[(2-ethylcyclohexen-1-yl)methylideneamino]-2-N,2-N-dihydroxy-4-N,4-N-dioxidobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 163163694 |
| Molecular Formula | C15H20N4O4-2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-N-[(2-ethylcyclohexen-1-yl)methylideneamino]-2-N,2-N-dihydroxy-4-N,4-N-dioxidobenzene-1,2,4-triamine |
| SMILES | CCC1=C(C=NNc2ccc(N([O-])[O-])cc2N(O)O)CCCC1 |
| InChI | InChI=1S/C15H20N4O4/c1-2-11-5-3-4-6-12(11)10-16-17-14-8-7-13(18(20)21)9-15(14)19(22)23/h7-10,17,22-23H,2-6H2,1H3/q-2 |
| InChIKey | KUYYWCGJCDMUQX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|