C6H5ClN2O4-2 — CID 163164042
4-chloro-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine (PubChem CID 163164042) has the molecular formula C6H5ClN2O4-2 and a molecular weight of 204.57 g/mol. Its IUPAC name is 4-chloro-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine.
| Compound Name | 4-chloro-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine |
|---|---|
| PubChem CID | 163164042 |
| Molecular Formula | C6H5ClN2O4-2 |
| Molecular Weight | 204.57 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 4-chloro-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine |
| SMILES | [O-]N([O-])c1ccc(Cl)c(N(O)O)c1 |
| InChI | InChI=1S/C6H5ClN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3,12-13H/q-2 |
| InChIKey | OAPZWEWOIJEBIH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|