C8H6F3N3O5-2 — CID 163147693
N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 163147693) has the molecular formula C8H6F3N3O5-2 and a molecular weight of 281.15 g/mol. Its IUPAC name is N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 163147693 |
| Molecular Formula | C8H6F3N3O5-2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(N([O-])[O-])cc1N(O)O)C(F)(F)F |
| InChI | InChI=1S/C8H6F3N3O5/c9-8(10,11)7(15)12-5-2-1-4(13(16)17)3-6(5)14(18)19/h1-3,18-19H,(H,12,15)/q-2 |
| InChIKey | VNKXIXLNVWPIJK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|