C10H5BrClF6N2O3- — CID 163149607
2-bromo-N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 163149607) has the molecular formula C10H5BrClF6N2O3- and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-bromo-N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | 2-bromo-N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 163149607 |
| Molecular Formula | C10H5BrClF6N2O3- |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 428.91 |
| IUPAC Name | 2-bromo-N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | O=C(Nc1ccc(Cl)cc1N([O-])O)C(Br)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5BrClF6N2O3/c11-8(9(13,14)15,10(16,17)18)7(21)19-5-2-1-4(12)3-6(5)20(22)23/h1-3,22H,(H,19,21)/q-1 |
| InChIKey | CRBQPABHESUPFS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|