C10H12N4O4-2 — CID 163172164
2-N,2-N-dihydroxy-1-N-(2-methylprop-2-enylideneamino)-4-N,4-N-dioxidobenzene-1,2,4-triamine (PubChem CID 163172164) has the molecular formula C10H12N4O4-2 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-N,2-N-dihydroxy-1-N-(2-methylprop-2-enylideneamino)-4-N,4-N-dioxidobenzene-1,2,4-triamine.
| Compound Name | 2-N,2-N-dihydroxy-1-N-(2-methylprop-2-enylideneamino)-4-N,4-N-dioxidobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 163172164 |
| Molecular Formula | C10H12N4O4-2 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-N,2-N-dihydroxy-1-N-(2-methylprop-2-enylideneamino)-4-N,4-N-dioxidobenzene-1,2,4-triamine |
| SMILES | C=C(C)C=NNc1ccc(N([O-])[O-])cc1N(O)O |
| InChI | InChI=1S/C10H12N4O4/c1-7(2)6-11-12-9-4-3-8(13(15)16)5-10(9)14(17)18/h3-6,12,17-18H,1H2,2H3/q-2 |
| InChIKey | QDBWETUHGUVUOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|