C22H18Cl4N4O8-4 — CID 163166263
4-[(1R,2S)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethyl]phenyl]ethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine (PubChem CID 163166263) has the molecular formula C22H18Cl4N4O8-4 and a molecular weight of 608.22 g/mol. Its IUPAC name is 4-[(1R,2S)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethyl]phenyl]ethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine.
| Compound Name | 4-[(1R,2S)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethyl]phenyl]ethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine |
|---|---|
| PubChem CID | 163166263 |
| Molecular Formula | C22H18Cl4N4O8-4 |
| Molecular Weight | 608.22 g/mol |
| Exact Mass | 605.99 |
| IUPAC Name | 4-[(1R,2S)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]ethyl]phenyl]ethyl]-3-N,3-N-dihydroxy-1-N,1-N-dioxidobenzene-1,3-diamine |
| SMILES | [O-]N([O-])c1ccc([C@@H](Cl)[C@@H](Cl)c2ccc([C@@H](Cl)[C@@H](Cl)c3ccc(N([O-])[O-])cc3N(O)O)cc2)c(N(O)O)c1 |
| InChI | InChI=1S/C22H18Cl4N4O8/c23-19(21(25)15-7-5-13(27(31)32)9-17(15)29(35)36)11-1-2-12(4-3-11)20(24)22(26)16-8-6-14(28(33)34)10-18(16)30(37)38/h1-10,19-22,35-38H/q-4/t19-,20+,21+,22- |
| InChIKey | YVUYSHXWFIXDTF-ZDNVTZCJSA-N |
| XLogP | 6.98 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.22 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|