C14H8Cl4N2O4 — CID 3656319
1-chloro-4-[2,2-dichloro-1-(2-chloro-5-nitrophenyl)ethyl]-2-nitrobenzene (PubChem CID 3656319) has the molecular formula C14H8Cl4N2O4 and a molecular weight of 410.04 g/mol. Its IUPAC name is 1-chloro-4-[2,2-dichloro-1-(2-chloro-5-nitrophenyl)ethyl]-2-nitrobenzene.
| Compound Name | 1-chloro-4-[2,2-dichloro-1-(2-chloro-5-nitrophenyl)ethyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 3656319 |
| Molecular Formula | C14H8Cl4N2O4 |
| Molecular Weight | 410.04 g/mol |
| Exact Mass | 407.92 |
| IUPAC Name | 1-chloro-4-[2,2-dichloro-1-(2-chloro-5-nitrophenyl)ethyl]-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C(c2ccc(Cl)c([N+](=O)[O-])c2)C(Cl)Cl)c1 |
| InChI | InChI=1S/C14H8Cl4N2O4/c15-10-4-2-8(19(21)22)6-9(10)13(14(17)18)7-1-3-11(16)12(5-7)20(23)24/h1-6,13-14H |
| InChIKey | PJHYQDMWWPESTB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|