C10H8N2O7 — CID 87543788
2-[(2,4-dinitrophenyl)-hydroxymethyl]prop-2-enoic acid (PubChem CID 87543788) has the molecular formula C10H8N2O7 and a molecular weight of 268.18 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)-hydroxymethyl]prop-2-enoic acid.
| Compound Name | 2-[(2,4-dinitrophenyl)-hydroxymethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87543788 |
| Molecular Formula | C10H8N2O7 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)-hydroxymethyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C(O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N2O7/c1-5(10(14)15)9(13)7-3-2-6(11(16)17)4-8(7)12(18)19/h2-4,9,13H,1H2,(H,14,15) |
| InChIKey | QGWCKTOLPBQSER-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|