C11H11NO6 — CID 134657937
2-hydroxy-2-[5-nitro-2-(2-oxopropyl)phenyl]acetic acid (PubChem CID 134657937) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is 2-hydroxy-2-[5-nitro-2-(2-oxopropyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[5-nitro-2-(2-oxopropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134657937 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-hydroxy-2-[5-nitro-2-(2-oxopropyl)phenyl]acetic acid |
| SMILES | CC(=O)Cc1ccc([N+](=O)[O-])cc1C(O)C(=O)O |
| InChI | InChI=1S/C11H11NO6/c1-6(13)4-7-2-3-8(12(17)18)5-9(7)10(14)11(15)16/h2-3,5,10,14H,4H2,1H3,(H,15,16) |
| InChIKey | RSUVAXHVZIOISH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|