2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid

C10H11NO5 — CID 118806557

IUPAC2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid
SMILESCc1cc(C(O)C(=O)O)c([N+](=O)[O-])cc1C
InChIInChI=1S/C10H11NO5/c1-5-3-7(9(12)10(13)14)8(11(15)16)4-6(5)2/h3-4,9,12H,1-2H3,(H,13,14)
InChIKeyXYQQNWAIBZYWAL-UHFFFAOYSA-N
MW225.20 g/mol
LogP1.33
Rot. Bonds3

About 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid

2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid (PubChem CID 118806557) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid
PubChem CID118806557
Molecular FormulaC10H11NO5
Molecular Weight225.20 g/mol
Exact Mass225.06
IUPAC Name2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid
SMILESCc1cc(C(O)C(=O)O)c([N+](=O)[O-])cc1C
InChIInChI=1S/C10H11NO5/c1-5-3-7(9(12)10(13)14)8(11(15)16)4-6(5)2/h3-4,9,12H,1-2H3,(H,13,14)
InChIKeyXYQQNWAIBZYWAL-UHFFFAOYSA-N
XLogP1.33
TPSA100.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.20
LogP ≤ 51.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid?
The IUPAC name of 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid (CID 118806557) is 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid is Cc1cc(C(O)C(=O)O)c([N+](=O)[O-])cc1C.
What is the InChIKey of 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid?
The InChIKey is XYQQNWAIBZYWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5/c1-5-3-7(9(12)10(13)14)8(11(15)16)4-6(5)2/h3-4,9,12H,1-2H3,(H,13,14).
What are the key properties of 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid?
2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid has a molecular weight of 225.20 g/mol, XLogP of 1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-2-nitrophenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 118806557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).