About 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid
2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid (PubChem CID 117108576) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid.
Analyze 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid?
The IUPAC name of 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid (CID 117108576) is 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid.
What is the SMILES notation for 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid?
The canonical SMILES for 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid is Cc1cc(C(O)C(=O)O)c(N(C)C)cc1C.
What is the InChIKey of 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid?
The InChIKey is CBKWLTRGLXPYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-7-5-9(11(14)12(15)16)10(13(3)4)6-8(7)2/h5-6,11,14H,1-4H3,(H,15,16).
What are the key properties of 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid?
2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid has a molecular weight of 223.27 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)-4,5-dimethylphenyl]-2-hydroxyacetic acid is sourced from PubChem (CID 117108576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).