C11H14O4 — CID 119014767
2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid (PubChem CID 119014767) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid.
| Compound Name | 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 119014767 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid |
| SMILES | COc1cc(C)c(C)c(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C11H14O4/c1-6-4-8(15-3)5-9(7(6)2)10(12)11(13)14/h4-5,10,12H,1-3H3,(H,13,14) |
| InChIKey | QEEGZLZJQMDVSA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |