2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid

C11H14O4 — CID 119014767

IUPAC2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid
SMILESCOc1cc(C)c(C)c(C(O)C(=O)O)c1
InChIInChI=1S/C11H14O4/c1-6-4-8(15-3)5-9(7(6)2)10(12)11(13)14/h4-5,10,12H,1-3H3,(H,13,14)
InChIKeyQEEGZLZJQMDVSA-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.43
Rot. Bonds3

About 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid

2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid (PubChem CID 119014767) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid
PubChem CID119014767
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid
SMILESCOc1cc(C)c(C)c(C(O)C(=O)O)c1
InChIInChI=1S/C11H14O4/c1-6-4-8(15-3)5-9(7(6)2)10(12)11(13)14/h4-5,10,12H,1-3H3,(H,13,14)
InChIKeyQEEGZLZJQMDVSA-UHFFFAOYSA-N
XLogP1.43
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid?
The IUPAC name of 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid (CID 119014767) is 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid?
The canonical SMILES for 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid is COc1cc(C)c(C)c(C(O)C(=O)O)c1.
What is the InChIKey of 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid?
The InChIKey is QEEGZLZJQMDVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-6-4-8(15-3)5-9(7(6)2)10(12)11(13)14/h4-5,10,12H,1-3H3,(H,13,14).
What are the key properties of 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid?
2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid has a molecular weight of 210.23 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(5-methoxy-2,3-dimethylphenyl)acetic acid is sourced from PubChem (CID 119014767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).