C11H14O7S — CID 117468875
2-(2,5-dimethoxy-3-methylsulfonylphenyl)-2-hydroxyacetic acid (PubChem CID 117468875) has the molecular formula C11H14O7S and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-3-methylsulfonylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,5-dimethoxy-3-methylsulfonylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117468875 |
| Molecular Formula | C11H14O7S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(2,5-dimethoxy-3-methylsulfonylphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(C(O)C(=O)O)c(OC)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H14O7S/c1-17-6-4-7(9(12)11(13)14)10(18-2)8(5-6)19(3,15)16/h4-5,9,12H,1-3H3,(H,13,14) |
| InChIKey | XKVDGHLIXNLUII-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |