C12H17NO6S — CID 117488381
3-amino-3-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid (PubChem CID 117488381) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-amino-3-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid.
| Compound Name | 3-amino-3-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117488381 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-amino-3-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid |
| SMILES | COc1cc(C(N)CC(=O)O)c(OC)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H17NO6S/c1-18-7-4-8(9(13)6-11(14)15)12(19-2)10(5-7)20(3,16)17/h4-5,9H,6,13H2,1-3H3,(H,14,15) |
| InChIKey | LGJQBXWZKYXSAZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |