C11H16ClNO4 — CID 155888018
3-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride (PubChem CID 155888018) has the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. Its IUPAC name is 3-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride.
| Compound Name | 3-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 155888018 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride |
| SMILES | COc1cc(OC)cc(C(N)CC(=O)O)c1.Cl |
| InChI | InChI=1S/C11H15NO4.ClH/c1-15-8-3-7(4-9(5-8)16-2)10(12)6-11(13)14;/h3-5,10H,6,12H2,1-2H3,(H,13,14);1H |
| InChIKey | KHOXCFRQQWIJDU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |