C9H11NO4 — CID 55273061
(3S)-3-amino-3-(3,5-dihydroxyphenyl)propanoic acid (PubChem CID 55273061) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is (3S)-3-amino-3-(3,5-dihydroxyphenyl)propanoic acid.
| Compound Name | (3S)-3-amino-3-(3,5-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 55273061 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (3S)-3-amino-3-(3,5-dihydroxyphenyl)propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H11NO4/c10-8(4-9(13)14)5-1-6(11)3-7(12)2-5/h1-3,8,11-12H,4,10H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | UKWNZNCAYHCDMS-QMMMGPOBSA-N |
| XLogP | 0.57 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |