C10H11F2NO2 — CID 79016031
(3S)-3-amino-3-[4-(difluoromethyl)phenyl]propanoic acid (PubChem CID 79016031) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is (3S)-3-amino-3-[4-(difluoromethyl)phenyl]propanoic acid.
| Compound Name | (3S)-3-amino-3-[4-(difluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 79016031 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (3S)-3-amino-3-[4-(difluoromethyl)phenyl]propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C10H11F2NO2/c11-10(12)7-3-1-6(2-4-7)8(13)5-9(14)15/h1-4,8,10H,5,13H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | VSQHLMUGLHSFKV-QMMMGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |