About 3-amino-3-(4-chlorophenyl)propanoic acid;azane
3-amino-3-(4-chlorophenyl)propanoic acid;azane (PubChem CID 175752194) has the molecular formula C9H13ClN2O2
and a molecular weight of 216.67 g/mol. Its IUPAC name is 3-amino-3-(4-chlorophenyl)propanoic acid;azane.
Molecular Properties
| Compound Name | 3-amino-3-(4-chlorophenyl)propanoic acid;azane |
| PubChem CID | 175752194 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-amino-3-(4-chlorophenyl)propanoic acid;azane |
| SMILES | N.NC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10ClNO2.H3N/c10-7-3-1-6(2-4-7)8(11)5-9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H3 |
| InChIKey | XPBNJPOCSRAKIJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-3-(4-chlorophenyl)propanoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(4-chlorophenyl)propanoic acid;azane?
The IUPAC name of 3-amino-3-(4-chlorophenyl)propanoic acid;azane (CID 175752194) is 3-amino-3-(4-chlorophenyl)propanoic acid;azane.
What is the SMILES notation for 3-amino-3-(4-chlorophenyl)propanoic acid;azane?
The canonical SMILES for 3-amino-3-(4-chlorophenyl)propanoic acid;azane is N.NC(CC(=O)O)c1ccc(Cl)cc1.
What is the InChIKey of 3-amino-3-(4-chlorophenyl)propanoic acid;azane?
The InChIKey is XPBNJPOCSRAKIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2.H3N/c10-7-3-1-6(2-4-7)8(11)5-9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H3.
What are the key properties of 3-amino-3-(4-chlorophenyl)propanoic acid;azane?
3-amino-3-(4-chlorophenyl)propanoic acid;azane has a molecular weight of 216.67 g/mol, XLogP of 1.98, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(4-chlorophenyl)propanoic acid;azane is sourced from PubChem (CID 175752194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).