C9H10ClNO4 — CID 90880382
(3S)-3-amino-3-(3-chloro-4,5-dihydroxyphenyl)propanoic acid (PubChem CID 90880382) has the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. Its IUPAC name is (3S)-3-amino-3-(3-chloro-4,5-dihydroxyphenyl)propanoic acid.
| Compound Name | (3S)-3-amino-3-(3-chloro-4,5-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 90880382 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | (3S)-3-amino-3-(3-chloro-4,5-dihydroxyphenyl)propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1cc(O)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClNO4/c10-5-1-4(2-7(12)9(5)15)6(11)3-8(13)14/h1-2,6,12,15H,3,11H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | MMWXVUIWHNPSOC-LURJTMIESA-N |
| XLogP | 1.23 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|