C12H16FNO2 — CID 84790187
3-amino-3-(3-fluoro-5-propan-2-ylphenyl)propanoic acid (PubChem CID 84790187) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 3-amino-3-(3-fluoro-5-propan-2-ylphenyl)propanoic acid.
| Compound Name | 3-amino-3-(3-fluoro-5-propan-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 84790187 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-amino-3-(3-fluoro-5-propan-2-ylphenyl)propanoic acid |
| SMILES | CC(C)c1cc(F)cc(C(N)CC(=O)O)c1 |
| InChI | InChI=1S/C12H16FNO2/c1-7(2)8-3-9(5-10(13)4-8)11(14)6-12(15)16/h3-5,7,11H,6,14H2,1-2H3,(H,15,16) |
| InChIKey | AEGAYMXLQKNRIS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |