C13H17NO5 — CID 63650220
(3R)-3-acetamido-3-(3,5-dimethoxyphenyl)propanoic acid (PubChem CID 63650220) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (3R)-3-acetamido-3-(3,5-dimethoxyphenyl)propanoic acid.
| Compound Name | (3R)-3-acetamido-3-(3,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 63650220 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3R)-3-acetamido-3-(3,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(OC)cc([C@@H](CC(=O)O)NC(C)=O)c1 |
| InChI | InChI=1S/C13H17NO5/c1-8(15)14-12(7-13(16)17)9-4-10(18-2)6-11(5-9)19-3/h4-6,12H,7H2,1-3H3,(H,14,15)(H,16,17)/t12-/m1/s1 |
| InChIKey | YTSJAIHJVJGDLJ-GFCCVEGCSA-N |
| XLogP | 1.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |